C17H25N3O2 — CID 110776055
1-propan-2-yl-3-[2-(1,3,3-trimethyl-2-oxoindol-5-yl)ethyl]urea (PubChem CID 110776055) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-propan-2-yl-3-[2-(1,3,3-trimethyl-2-oxoindol-5-yl)ethyl]urea.
| Compound Name | 1-propan-2-yl-3-[2-(1,3,3-trimethyl-2-oxoindol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 110776055 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-propan-2-yl-3-[2-(1,3,3-trimethyl-2-oxoindol-5-yl)ethyl]urea |
| SMILES | CC(C)NC(=O)NCCc1ccc2c(c1)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C17H25N3O2/c1-11(2)19-16(22)18-9-8-12-6-7-14-13(10-12)17(3,4)15(21)20(14)5/h6-7,10-11H,8-9H2,1-5H3,(H2,18,19,22) |
| InChIKey | WJBWDQYXFNOSOW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |