C17H24O5 — CID 11077709
diethyl 2-[(1S,5R)-6-methylidene-3-oxo-1-bicyclo[3.2.1]octanyl]butanedioate (PubChem CID 11077709) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is diethyl 2-[(1S,5R)-6-methylidene-3-oxo-1-bicyclo[3.2.1]octanyl]butanedioate.
| Compound Name | diethyl 2-[(1S,5R)-6-methylidene-3-oxo-1-bicyclo[3.2.1]octanyl]butanedioate |
|---|---|
| PubChem CID | 11077709 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | diethyl 2-[(1S,5R)-6-methylidene-3-oxo-1-bicyclo[3.2.1]octanyl]butanedioate |
| SMILES | C=C1C[C@]2(C(CC(=O)OCC)C(=O)OCC)CC(=O)C[C@H]1C2 |
| InChI | InChI=1S/C17H24O5/c1-4-21-15(19)7-14(16(20)22-5-2)17-8-11(3)12(9-17)6-13(18)10-17/h12,14H,3-10H2,1-2H3/t12-,14?,17+/m0/s1 |
| InChIKey | KAJMSKDDTBCRNW-WAPNNBGYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|