C26H46O3Sn — CID 11731084
ethyl 2-methylidene-10-oxo-4-tributylstannylspiro[4.5]decane-3-carboxylate (PubChem CID 11731084) has the molecular formula C26H46O3Sn and a molecular weight of 525.36 g/mol. Its IUPAC name is ethyl 2-methylidene-10-oxo-4-tributylstannylspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl 2-methylidene-10-oxo-4-tributylstannylspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 11731084 |
| Molecular Formula | C26H46O3Sn |
| Molecular Weight | 525.36 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | ethyl 2-methylidene-10-oxo-4-tributylstannylspiro[4.5]decane-3-carboxylate |
| SMILES | C=C1CC2(CCCCC2=O)C([Sn](CCCC)(CCCC)CCCC)C1C(=O)OCC |
| InChI | InChI=1S/C14H19O3.3C4H9.Sn/c1-3-17-13(16)11-9-14(8-10(11)2)7-5-4-6-12(14)15;3*1-3-4-2;/h9,11H,2-8H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | PSHZSOQCGLSNLX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.36 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|