C19H30O3 — CID 14658023
tert-butyl 2-(3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl)-3-methylbut-3-enoate (PubChem CID 14658023) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl 2-(3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl)-3-methylbut-3-enoate.
| Compound Name | tert-butyl 2-(3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl)-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 14658023 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | tert-butyl 2-(3a-methyl-7-oxo-2,3,4,5,6,7a-hexahydro-1H-inden-1-yl)-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OC(C)(C)C)C1CCC2(C)CCCC(=O)C12 |
| InChI | InChI=1S/C19H30O3/c1-12(2)15(17(21)22-18(3,4)5)13-9-11-19(6)10-7-8-14(20)16(13)19/h13,15-16H,1,7-11H2,2-6H3 |
| InChIKey | VZENVPSGDLHXJD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|