C15H12F2N2O3S — CID 110782261
N-[(2,4-difluorophenyl)methyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110782261) has the molecular formula C15H12F2N2O3S and a molecular weight of 338.34 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110782261 |
| Molecular Formula | C15H12F2N2O3S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)NCc3ccc(F)cc3F)ccc2N1 |
| InChI | InChI=1S/C15H12F2N2O3S/c16-11-2-1-9(13(17)7-11)8-18-23(21,22)12-3-4-14-10(5-12)6-15(20)19-14/h1-5,7,18H,6,8H2,(H,19,20) |
| InChIKey | NGWQLEFWQMXCGC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |