C17H14F3NO3 — CID 11078235
benzyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate (PubChem CID 11078235) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is benzyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate.
| Compound Name | benzyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
|---|---|
| PubChem CID | 11078235 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | benzyl 3,3,3-trifluoro-2-(4-methoxyphenyl)iminopropanoate |
| SMILES | COc1ccc(/N=C(\C(=O)OCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO3/c1-23-14-9-7-13(8-10-14)21-15(17(18,19)20)16(22)24-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3/b21-15+ |
| InChIKey | MSAJUJYJVVKVGN-RCCKNPSSSA-N |
| XLogP | 4.07 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|