C12H12BrF2NO3 — CID 11209878
ethyl 3-bromo-3,3-difluoro-2-(4-methoxyphenyl)iminopropanoate (PubChem CID 11209878) has the molecular formula C12H12BrF2NO3 and a molecular weight of 336.13 g/mol. Its IUPAC name is ethyl 3-bromo-3,3-difluoro-2-(4-methoxyphenyl)iminopropanoate.
| Compound Name | ethyl 3-bromo-3,3-difluoro-2-(4-methoxyphenyl)iminopropanoate |
|---|---|
| PubChem CID | 11209878 |
| Molecular Formula | C12H12BrF2NO3 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | ethyl 3-bromo-3,3-difluoro-2-(4-methoxyphenyl)iminopropanoate |
| SMILES | CCOC(=O)/C(=N\c1ccc(OC)cc1)C(F)(F)Br |
| InChI | InChI=1S/C12H12BrF2NO3/c1-3-19-11(17)10(12(13,14)15)16-8-4-6-9(18-2)7-5-8/h4-7H,3H2,1-2H3/b16-10+ |
| InChIKey | LVBQGKDBFNFICW-MHWRWJLKSA-N |
| XLogP | 3.32 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|