C14H16N2O4S2 — CID 110783971
N-[2-methoxy-5-[(thiophen-2-ylsulfonylamino)methyl]phenyl]acetamide (PubChem CID 110783971) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[2-methoxy-5-[(thiophen-2-ylsulfonylamino)methyl]phenyl]acetamide.
| Compound Name | N-[2-methoxy-5-[(thiophen-2-ylsulfonylamino)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110783971 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-[2-methoxy-5-[(thiophen-2-ylsulfonylamino)methyl]phenyl]acetamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cccs2)cc1NC(C)=O |
| InChI | InChI=1S/C14H16N2O4S2/c1-10(17)16-12-8-11(5-6-13(12)20-2)9-15-22(18,19)14-4-3-7-21-14/h3-8,15H,9H2,1-2H3,(H,16,17) |
| InChIKey | LUTOQHPWVNMHJP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |