C14H15N3O2S2 — CID 110785688
5-methyl-N-[(2-methyl-3H-benzimidazol-5-yl)methyl]thiophene-2-sulfonamide (PubChem CID 110785688) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 5-methyl-N-[(2-methyl-3H-benzimidazol-5-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(2-methyl-3H-benzimidazol-5-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110785688 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-methyl-N-[(2-methyl-3H-benzimidazol-5-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1nc2ccc(CNS(=O)(=O)c3ccc(C)s3)cc2[nH]1 |
| InChI | InChI=1S/C14H15N3O2S2/c1-9-3-6-14(20-9)21(18,19)15-8-11-4-5-12-13(7-11)17-10(2)16-12/h3-7,15H,8H2,1-2H3,(H,16,17) |
| InChIKey | DPNJFWJEGUGIJB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |