C17H18FN3O2S — CID 110791557
1-(4-fluorophenyl)-N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]methanesulfonamide (PubChem CID 110791557) has the molecular formula C17H18FN3O2S and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110791557 |
| Molecular Formula | C17H18FN3O2S |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]methanesulfonamide |
| SMILES | Cc1nc2ccc(CCNS(=O)(=O)Cc3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C17H18FN3O2S/c1-12-20-16-7-4-13(10-17(16)21-12)8-9-19-24(22,23)11-14-2-5-15(18)6-3-14/h2-7,10,19H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | QFWSQOVNNNJYBE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |