C21H36O2Si — CID 11078581
(Z)-1-[3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpent-1-en-4-yn-3-ol (PubChem CID 11078581) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (Z)-1-[3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpent-1-en-4-yn-3-ol.
| Compound Name | (Z)-1-[3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpent-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 11078581 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (Z)-1-[3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpent-1-en-4-yn-3-ol |
| SMILES | C#CC(C)(O)/C=C\C1=C(C)C(O[Si](C)(C)C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-11-21(8,22)15-12-17-16(2)18(13-14-20(17,6)7)23-24(9,10)19(3,4)5/h1,12,15,18,22H,13-14H2,2-10H3/b15-12- |
| InChIKey | UNJGWWYSDMIVIB-QINSGFPZSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|