C21H27N3O — CID 110785997
N-[(1,2-dimethylbenzimidazol-5-yl)methyl]adamantane-1-carboxamide (PubChem CID 110785997) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[(1,2-dimethylbenzimidazol-5-yl)methyl]adamantane-1-carboxamide.
| Compound Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110785997 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]adamantane-1-carboxamide |
| SMILES | Cc1nc2cc(CNC(=O)C34CC5CC(CC(C5)C3)C4)ccc2n1C |
| InChI | InChI=1S/C21H27N3O/c1-13-23-18-8-14(3-4-19(18)24(13)2)12-22-20(25)21-9-15-5-16(10-21)7-17(6-15)11-21/h3-4,8,15-17H,5-7,9-12H2,1-2H3,(H,22,25) |
| InChIKey | VHCALKBXFJYNQY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |