C23H27NO3 — CID 11079055
(5S,6S)-6-[(1S)-1-(dibenzylamino)ethyl]-1,7-dioxaspiro[4.4]nonan-4-one (PubChem CID 11079055) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (5S,6S)-6-[(1S)-1-(dibenzylamino)ethyl]-1,7-dioxaspiro[4.4]nonan-4-one.
| Compound Name | (5S,6S)-6-[(1S)-1-(dibenzylamino)ethyl]-1,7-dioxaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 11079055 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (5S,6S)-6-[(1S)-1-(dibenzylamino)ethyl]-1,7-dioxaspiro[4.4]nonan-4-one |
| SMILES | C[C@@H]([C@@H]1OCC[C@]12OCCC2=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO3/c1-18(22-23(13-15-26-22)21(25)12-14-27-23)24(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-11,18,22H,12-17H2,1H3/t18-,22-,23+/m0/s1 |
| InChIKey | LZNZIWVBLZCLFY-OFAXGOBFSA-N |
| XLogP | 3.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |