C29H35NO5 — CID 15305040
(4S,5S,6S,7S)-4-[(1S)-1-(dibenzylamino)ethyl]-3,8,14,17-tetraoxatrispiro[4.0.0.47.36.35]heptadecan-11-one (PubChem CID 15305040) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is (4S,5S,6S,7S)-4-[(1S)-1-(dibenzylamino)ethyl]-3,8,14,17-tetraoxatrispiro[4.0.0.47.36.35]heptadecan-11-one.
| Compound Name | (4S,5S,6S,7S)-4-[(1S)-1-(dibenzylamino)ethyl]-3,8,14,17-tetraoxatrispiro[4.0.0.47.36.35]heptadecan-11-one |
|---|---|
| PubChem CID | 15305040 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (4S,5S,6S,7S)-4-[(1S)-1-(dibenzylamino)ethyl]-3,8,14,17-tetraoxatrispiro[4.0.0.47.36.35]heptadecan-11-one |
| SMILES | C[C@@H]([C@@H]1OCC[C@]12OCC[C@]21OCC[C@]12OCCC2=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO5/c1-22(30(20-23-8-4-2-5-9-23)21-24-10-6-3-7-11-24)26-28(13-17-32-26)29(15-19-34-28)27(14-18-35-29)25(31)12-16-33-27/h2-11,22,26H,12-21H2,1H3/t22-,26-,27+,28-,29+/m0/s1 |
| InChIKey | KNQFBEXSCSFJRF-YOELTNQESA-N |
| XLogP | 3.91 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |