C21H32N2O4 — CID 11079339
2-O-tert-butyl 4-O-methyl (2R,4S)-1-[2-(benzylamino)ethyl]-4-methylpyrrolidine-2,4-dicarboxylate (PubChem CID 11079339) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl (2R,4S)-1-[2-(benzylamino)ethyl]-4-methylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-methyl (2R,4S)-1-[2-(benzylamino)ethyl]-4-methylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11079339 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl (2R,4S)-1-[2-(benzylamino)ethyl]-4-methylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@H](C(=O)OC(C)(C)C)N(CCNCc2ccccc2)C1 |
| InChI | InChI=1S/C21H32N2O4/c1-20(2,3)27-18(24)17-13-21(4,19(25)26-5)15-23(17)12-11-22-14-16-9-7-6-8-10-16/h6-10,17,22H,11-15H2,1-5H3/t17-,21+/m1/s1 |
| InChIKey | NKOWPSKWKRNALL-UTKZUKDTSA-N |
| XLogP | 2.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|