C21H30N2O6 — CID 167358683
1-O-tert-butyl 3-O-methyl 3-methyl-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate (PubChem CID 167358683) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-methyl-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-methyl-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 167358683 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-methyl-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(C)CC(NC(=O)OCc2ccccc2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30N2O6/c1-20(2,3)29-19(26)23-12-16(11-21(4,14-23)17(24)27-5)22-18(25)28-13-15-9-7-6-8-10-15/h6-10,16H,11-14H2,1-5H3,(H,22,25) |
| InChIKey | VLSFCJDSKJMKTD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|