C22H26N2O2Si — CID 11079393
(2R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxopiperidine-2-carbonitrile (PubChem CID 11079393) has the molecular formula C22H26N2O2Si and a molecular weight of 378.55 g/mol. Its IUPAC name is (2R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxopiperidine-2-carbonitrile.
| Compound Name | (2R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxopiperidine-2-carbonitrile |
|---|---|
| PubChem CID | 11079393 |
| Molecular Formula | C22H26N2O2Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (2R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-6-oxopiperidine-2-carbonitrile |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC(=O)N[C@@H](C#N)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2Si/c1-22(2,3)27(19-10-6-4-7-11-19,20-12-8-5-9-13-20)26-18-14-17(16-23)24-21(25)15-18/h4-13,17-18H,14-15H2,1-3H3,(H,24,25)/t17-,18+/m1/s1 |
| InChIKey | OZIBXQFAAQEQHX-MSOLQXFVSA-N |
| XLogP | 2.73 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|