C22H29NO3Si — CID 11383512
(4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxypiperidin-2-one (PubChem CID 11383512) has the molecular formula C22H29NO3Si and a molecular weight of 383.56 g/mol. Its IUPAC name is (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxypiperidin-2-one.
| Compound Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxypiperidin-2-one |
|---|---|
| PubChem CID | 11383512 |
| Molecular Formula | C22H29NO3Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-methoxypiperidin-2-one |
| SMILES | CO[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)N1 |
| InChI | InChI=1S/C22H29NO3Si/c1-22(2,3)27(18-11-7-5-8-12-18,19-13-9-6-10-14-19)26-17-15-20(24)23-21(16-17)25-4/h5-14,17,21H,15-16H2,1-4H3,(H,23,24)/t17-,21+/m1/s1 |
| InChIKey | DACXDZATOQEZSW-UTKZUKDTSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|