C24H31NO2Si — CID 11731967
(4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-prop-2-enylpiperidin-2-one (PubChem CID 11731967) has the molecular formula C24H31NO2Si and a molecular weight of 393.60 g/mol. Its IUPAC name is (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-prop-2-enylpiperidin-2-one.
| Compound Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 11731967 |
| Molecular Formula | C24H31NO2Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (4S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)N1 |
| InChI | InChI=1S/C24H31NO2Si/c1-5-12-19-17-20(18-23(26)25-19)27-28(24(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h5-11,13-16,19-20H,1,12,17-18H2,2-4H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | KOLRSMZXCUCVJE-PMACEKPBSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|