C19H28N2O5 — CID 110800904
3-methyl-1-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 110800904) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 3-methyl-1-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110800904 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3-methyl-1-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | COc1cc(OC)c(C(=O)N2CCN(C(=O)CC(C)C)CC2)c(OC)c1 |
| InChI | InChI=1S/C19H28N2O5/c1-13(2)10-17(22)20-6-8-21(9-7-20)19(23)18-15(25-4)11-14(24-3)12-16(18)26-5/h11-13H,6-10H2,1-5H3 |
| InChIKey | BWLNSQCHTCGNSR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |