C19H23N3O5 — CID 110815460
1H-pyrrol-3-yl-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 110815460) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1H-pyrrol-3-yl-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | 1H-pyrrol-3-yl-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110815460 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1H-pyrrol-3-yl-[4-(2,4,6-trimethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(OC)c(C(=O)N2CCN(C(=O)c3cc[nH]c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-25-14-10-15(26-2)17(16(11-14)27-3)19(24)22-8-6-21(7-9-22)18(23)13-4-5-20-12-13/h4-5,10-12,20H,6-9H2,1-3H3 |
| InChIKey | IOPOSAUWTMRLGG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |