C21H32N2O3 — CID 110800955
1-[4-[2-(2-methoxy-5-propan-2-ylphenyl)acetyl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 110800955) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[4-[2-(2-methoxy-5-propan-2-ylphenyl)acetyl]piperazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[2-(2-methoxy-5-propan-2-ylphenyl)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110800955 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-[4-[2-(2-methoxy-5-propan-2-ylphenyl)acetyl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | COc1ccc(C(C)C)cc1CC(=O)N1CCN(C(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C21H32N2O3/c1-15(2)12-20(24)22-8-10-23(11-9-22)21(25)14-18-13-17(16(3)4)6-7-19(18)26-5/h6-7,13,15-16H,8-12,14H2,1-5H3 |
| InChIKey | GUSUMVLQBDBARV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |