C19H18F2N2O3 — CID 110809187
phenyl 4-(2,4-difluorobenzoyl)-1,4-diazepane-1-carboxylate (PubChem CID 110809187) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is phenyl 4-(2,4-difluorobenzoyl)-1,4-diazepane-1-carboxylate.
| Compound Name | phenyl 4-(2,4-difluorobenzoyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110809187 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | phenyl 4-(2,4-difluorobenzoyl)-1,4-diazepane-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H18F2N2O3/c20-14-7-8-16(17(21)13-14)18(24)22-9-4-10-23(12-11-22)19(25)26-15-5-2-1-3-6-15/h1-3,5-8,13H,4,9-12H2 |
| InChIKey | XDOXPXZRNJGDMC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |