C16H24N4O2 — CID 110813237
N-tert-butyl-4-(pyridine-2-carbonyl)-1,4-diazepane-1-carboxamide (PubChem CID 110813237) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-tert-butyl-4-(pyridine-2-carbonyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-(pyridine-2-carbonyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813237 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-tert-butyl-4-(pyridine-2-carbonyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(C(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-16(2,3)18-15(22)20-10-6-9-19(11-12-20)14(21)13-7-4-5-8-17-13/h4-5,7-8H,6,9-12H2,1-3H3,(H,18,22) |
| InChIKey | BJMHUSORUGMNFW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |