C21H25N3O2 — CID 110816030
pyridin-2-yl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 110816030) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is pyridin-2-yl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | pyridin-2-yl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110816030 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | pyridin-2-yl-[4-(2,4,5-trimethylbenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCCN(C(=O)c3ccccn3)CC2)cc1C |
| InChI | InChI=1S/C21H25N3O2/c1-15-13-17(3)18(14-16(15)2)20(25)23-9-6-10-24(12-11-23)21(26)19-7-4-5-8-22-19/h4-5,7-8,13-14H,6,9-12H2,1-3H3 |
| InChIKey | JHEIYRYFFDKOSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |