C17H19ClN4O2 — CID 110813582
N-(3-chlorophenyl)-4-(1H-pyrrole-3-carbonyl)-1,4-diazepane-1-carboxamide (PubChem CID 110813582) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1H-pyrrole-3-carbonyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-(1H-pyrrole-3-carbonyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813582 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1H-pyrrole-3-carbonyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCCN(C(=O)c2cc[nH]c2)CC1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-14-3-1-4-15(11-14)20-17(24)22-8-2-7-21(9-10-22)16(23)13-5-6-19-12-13/h1,3-6,11-12,19H,2,7-10H2,(H,20,24) |
| InChIKey | PKTHBQGFCULQHS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |