C28H28O6S — CID 11081508
6-tritylsulfanylhexane-1,3,3-tricarboxylic acid (PubChem CID 11081508) has the molecular formula C28H28O6S and a molecular weight of 492.59 g/mol. Its IUPAC name is 6-tritylsulfanylhexane-1,3,3-tricarboxylic acid.
| Compound Name | 6-tritylsulfanylhexane-1,3,3-tricarboxylic acid |
|---|---|
| PubChem CID | 11081508 |
| Molecular Formula | C28H28O6S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 6-tritylsulfanylhexane-1,3,3-tricarboxylic acid |
| SMILES | O=C(O)CCC(CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H28O6S/c29-24(30)17-19-27(25(31)32,26(33)34)18-10-20-35-28(21-11-4-1-5-12-21,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h1-9,11-16H,10,17-20H2,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | ACHMWJFCAQAIFA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|