C27H26N2O5S2 — CID 11081928
5,14-bis-(4-methylphenyl)sulfonyl-5,14-diazatetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-trien-10-one (PubChem CID 11081928) has the molecular formula C27H26N2O5S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 5,14-bis-(4-methylphenyl)sulfonyl-5,14-diazatetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-trien-10-one.
| Compound Name | 5,14-bis-(4-methylphenyl)sulfonyl-5,14-diazatetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-trien-10-one |
|---|---|
| PubChem CID | 11081928 |
| Molecular Formula | C27H26N2O5S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 5,14-bis-(4-methylphenyl)sulfonyl-5,14-diazatetracyclo[7.6.0.01,12.03,7]pentadeca-2,7,11-trien-10-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=CC4C(=O)C=C5CN(S(=O)(=O)c6ccc(C)cc6)CC54C=C3C2)cc1 |
| InChI | InChI=1S/C27H26N2O5S2/c1-18-3-7-23(8-4-18)35(31,32)28-14-20-11-25-26(30)12-22-16-29(17-27(22,25)13-21(20)15-28)36(33,34)24-9-5-19(2)6-10-24/h3-13,25H,14-17H2,1-2H3 |
| InChIKey | BEQCGQYHYWQXFS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |