C17H19ClN2O3S — CID 110824420
3-[2-(3-chloro-4-methylanilino)acetyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 110824420) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-[2-(3-chloro-4-methylanilino)acetyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[2-(3-chloro-4-methylanilino)acetyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110824420 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-[2-(3-chloro-4-methylanilino)acetyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(NCC(=O)c2cccc(S(=O)(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O3S/c1-12-7-8-14(10-16(12)18)19-11-17(21)13-5-4-6-15(9-13)24(22,23)20(2)3/h4-10,19H,11H2,1-3H3 |
| InChIKey | CKJOXPVFSVFUKH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |