C25H26FN3O3S — CID 110828198
2-[(4-fluorophenyl)methyl-pyridin-2-ylamino]-1-(4-piperidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110828198) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-pyridin-2-ylamino]-1-(4-piperidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[(4-fluorophenyl)methyl-pyridin-2-ylamino]-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110828198 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-pyridin-2-ylamino]-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CN(Cc1ccc(F)cc1)c1ccccn1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26FN3O3S/c26-22-11-7-20(8-12-22)18-28(25-6-2-3-15-27-25)19-24(30)21-9-13-23(14-10-21)33(31,32)29-16-4-1-5-17-29/h2-3,6-15H,1,4-5,16-19H2 |
| InChIKey | HGHZVVBIRAGIJA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |