C22H29N3O3S — CID 110829028
2-[[2-(dimethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110829028) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[[2-(dimethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110829028 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[[2-(dimethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | CN(C)C(CNCC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-24(2)21(18-9-4-3-5-10-18)16-23-17-22(26)19-11-8-12-20(15-19)29(27,28)25-13-6-7-14-25/h3-5,8-12,15,21,23H,6-7,13-14,16-17H2,1-2H3 |
| InChIKey | JNABEOQPMNBYMZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |