C24H33N3O3S — CID 110829029
2-[[2-(diethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110829029) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-[[2-(diethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[[2-(diethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110829029 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[[2-(diethylamino)-2-phenylethyl]amino]-1-(3-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | CCN(CC)C(CNCC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H33N3O3S/c1-3-26(4-2)23(20-11-6-5-7-12-20)18-25-19-24(28)21-13-10-14-22(17-21)31(29,30)27-15-8-9-16-27/h5-7,10-14,17,23,25H,3-4,8-9,15-16,18-19H2,1-2H3 |
| InChIKey | BTKGDUIWENLXMF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |