C23H30ClN3O3S — CID 24649835
2-chloro-N-[2-(diethylamino)-2-phenylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 24649835) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)-2-phenylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)-2-phenylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 24649835 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)-2-phenylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H30ClN3O3S/c1-3-26(4-2)22(18-10-6-5-7-11-18)17-25-23(28)20-16-19(12-13-21(20)24)31(29,30)27-14-8-9-15-27/h5-7,10-13,16,22H,3-4,8-9,14-15,17H2,1-2H3,(H,25,28) |
| InChIKey | ZEXICDDINXVTRR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |