C18H24N2O3 — CID 110830665
6-[3-[bis(prop-2-enyl)amino]-1-hydroxypropyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 110830665) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-[3-[bis(prop-2-enyl)amino]-1-hydroxypropyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[bis(prop-2-enyl)amino]-1-hydroxypropyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110830665 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-[3-[bis(prop-2-enyl)amino]-1-hydroxypropyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | C=CCN(CC=C)CCC(O)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C18H24N2O3/c1-4-9-20(10-5-2)11-8-16(21)14-6-7-17-15(12-14)19(3)18(22)13-23-17/h4-7,12,16,21H,1-2,8-11,13H2,3H3 |
| InChIKey | UOOCNVUSXBRFFU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|