C17H29NO5 — CID 110830674
3-[bis(2-methoxyethyl)amino]-1-(2,5-dimethoxyphenyl)propan-1-ol (PubChem CID 110830674) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-1-(2,5-dimethoxyphenyl)propan-1-ol.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-1-(2,5-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 110830674 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-1-(2,5-dimethoxyphenyl)propan-1-ol |
| SMILES | COCCN(CCOC)CCC(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H29NO5/c1-20-11-9-18(10-12-21-2)8-7-16(19)15-13-14(22-3)5-6-17(15)23-4/h5-6,13,16,19H,7-12H2,1-4H3 |
| InChIKey | WAPYQOAIGZSODO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |