C20H21N3O6 — CID 110831909
benzyl 2-(2-ethyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)butanoate (PubChem CID 110831909) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl 2-(2-ethyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)butanoate.
| Compound Name | benzyl 2-(2-ethyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)butanoate |
|---|---|
| PubChem CID | 110831909 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | benzyl 2-(2-ethyl-6-nitro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)butanoate |
| SMILES | CCC1Oc2ccc([N+](=O)[O-])nc2N(C(CC)C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H21N3O6/c1-3-14(20(25)28-12-13-8-6-5-7-9-13)22-18-16(29-15(4-2)19(22)24)10-11-17(21-18)23(26)27/h5-11,14-15H,3-4,12H2,1-2H3 |
| InChIKey | DWIQPUGBFGUKCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|