About 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one
2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110831951) has the molecular formula C13H15N3O5
and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one |
| PubChem CID | 110831951 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CCC1Oc2ccc([N+](=O)[O-])nc2N(CCC(C)=O)C1=O |
| InChI | InChI=1S/C13H15N3O5/c1-3-9-13(18)15(7-6-8(2)17)12-10(21-9)4-5-11(14-12)16(19)20/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | ZMNOBLFDHXCTOL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one?
The IUPAC name of 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one (CID 110831951) is 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one.
What is the SMILES notation for 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one?
The canonical SMILES for 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one is CCC1Oc2ccc([N+](=O)[O-])nc2N(CCC(C)=O)C1=O.
What is the InChIKey of 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one?
The InChIKey is ZMNOBLFDHXCTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O5/c1-3-9-13(18)15(7-6-8(2)17)12-10(21-9)4-5-11(14-12)16(19)20/h4-5,9H,3,6-7H2,1-2H3.
What are the key properties of 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one?
2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one has a molecular weight of 293.28 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-nitro-4-(3-oxobutyl)pyrido[3,2-b][1,4]oxazin-3-one is sourced from PubChem (CID 110831951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).