C20H21N3O5 — CID 110832010
2,2-dimethyl-6-nitro-4-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 110832010) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-4-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 2,2-dimethyl-6-nitro-4-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110832010 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2,2-dimethyl-6-nitro-4-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC(C)c1ccc(C(=O)CN2C(=O)C(C)(C)Oc3ccc([N+](=O)[O-])nc32)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-12(2)13-5-7-14(8-6-13)15(24)11-22-18-16(28-20(3,4)19(22)25)9-10-17(21-18)23(26)27/h5-10,12H,11H2,1-4H3 |
| InChIKey | BEFDBPOGZUFHCQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|