C38H64O9S2Si — CID 11083215
ethyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-5-hydroxy-8-methyl-3-oxononanoate (PubChem CID 11083215) has the molecular formula C38H64O9S2Si and a molecular weight of 757.14 g/mol. Its IUPAC name is ethyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-5-hydroxy-8-methyl-3-oxononanoate.
| Compound Name | ethyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-5-hydroxy-8-methyl-3-oxononanoate |
|---|---|
| PubChem CID | 11083215 |
| Molecular Formula | C38H64O9S2Si |
| Molecular Weight | 757.14 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | ethyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-5-hydroxy-8-methyl-3-oxononanoate |
| SMILES | CCOC(=O)CC(=O)C[C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C1(C[C@@H]2CC(OC)(OC)C[C@H](COCc3ccccc3)O2)SCCCS1 |
| InChI | InChI=1S/C38H64O9S2Si/c1-11-45-34(41)22-30(40)20-29(39)21-33(47-50(9,10)35(2,3)4)36(5,6)38(48-18-15-19-49-38)25-31-23-37(42-7,43-8)24-32(46-31)27-44-26-28-16-13-12-14-17-28/h12-14,16-17,29,31-33,39H,11,15,18-27H2,1-10H3/t29-,31+,32-,33+/m1/s1 |
| InChIKey | ZXQRFTYMHOMNLZ-PPESYSCFSA-N |
| XLogP | 7.78 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.14 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|