C9H14O4 — CID 11084563
4-hydroxy-6-methoxy-2,2,6-trimethylpyran-3-one (PubChem CID 11084563) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-hydroxy-6-methoxy-2,2,6-trimethylpyran-3-one.
| Compound Name | 4-hydroxy-6-methoxy-2,2,6-trimethylpyran-3-one |
|---|---|
| PubChem CID | 11084563 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-hydroxy-6-methoxy-2,2,6-trimethylpyran-3-one |
| SMILES | COC1(C)C=C(O)C(=O)C(C)(C)O1 |
| InChI | InChI=1S/C9H14O4/c1-8(2)7(11)6(10)5-9(3,12-4)13-8/h5,10H,1-4H3 |
| InChIKey | ZPTYBKABCJATPT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |