C6H8O4 — CID 170775278
(6S)-4,6-dihydroxy-6-methyl-2H-pyran-5-one (PubChem CID 170775278) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (6S)-4,6-dihydroxy-6-methyl-2H-pyran-5-one.
| Compound Name | (6S)-4,6-dihydroxy-6-methyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 170775278 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (6S)-4,6-dihydroxy-6-methyl-2H-pyran-5-one |
| SMILES | C[C@]1(O)OCC=C(O)C1=O |
| InChI | InChI=1S/C6H8O4/c1-6(9)5(8)4(7)2-3-10-6/h2,7,9H,3H2,1H3/t6-/m0/s1 |
| InChIKey | MAJMTWUGPSQOCM-LURJTMIESA-N |
| XLogP | -0.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |