C14H15ClN2O3S — CID 110852912
7-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-indole-2-carboxamide (PubChem CID 110852912) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 7-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110852912 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 7-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2cccc(Cl)c2[nH]1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-17(10-5-6-21(19,20)8-10)14(18)12-7-9-3-2-4-11(15)13(9)16-12/h2-4,7,10,16H,5-6,8H2,1H3 |
| InChIKey | GNTPQGQNCNCULD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |