About ethyl 4-ethyl-2,2-difluorooctanoate
ethyl 4-ethyl-2,2-difluorooctanoate (PubChem CID 11085779) has the molecular formula C12H22F2O2
and a molecular weight of 236.30 g/mol. Its IUPAC name is ethyl 4-ethyl-2,2-difluorooctanoate.
Molecular Properties
| Compound Name | ethyl 4-ethyl-2,2-difluorooctanoate |
| PubChem CID | 11085779 |
| Molecular Formula | C12H22F2O2 |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | ethyl 4-ethyl-2,2-difluorooctanoate |
| SMILES | CCCCC(CC)CC(F)(F)C(=O)OCC |
| InChI | InChI=1S/C12H22F2O2/c1-4-7-8-10(5-2)9-12(13,14)11(15)16-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | FNVQFCRFZFJBEZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 4-ethyl-2,2-difluorooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethyl-2,2-difluorooctanoate?
The IUPAC name of ethyl 4-ethyl-2,2-difluorooctanoate (CID 11085779) is ethyl 4-ethyl-2,2-difluorooctanoate.
What is the SMILES notation for ethyl 4-ethyl-2,2-difluorooctanoate?
The canonical SMILES for ethyl 4-ethyl-2,2-difluorooctanoate is CCCCC(CC)CC(F)(F)C(=O)OCC.
What is the InChIKey of ethyl 4-ethyl-2,2-difluorooctanoate?
The InChIKey is FNVQFCRFZFJBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O2/c1-4-7-8-10(5-2)9-12(13,14)11(15)16-6-3/h10H,4-9H2,1-3H3.
What are the key properties of ethyl 4-ethyl-2,2-difluorooctanoate?
ethyl 4-ethyl-2,2-difluorooctanoate has a molecular weight of 236.30 g/mol, XLogP of 3.79, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-2,2-difluorooctanoate is sourced from PubChem (CID 11085779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).