C12H12N2O2 — CID 110857869
N-ethyl-N-phenyl-1,3-oxazole-5-carboxamide (PubChem CID 110857869) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-ethyl-N-phenyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-ethyl-N-phenyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110857869 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-ethyl-N-phenyl-1,3-oxazole-5-carboxamide |
| SMILES | CCN(C(=O)c1cnco1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c1-2-14(10-6-4-3-5-7-10)12(15)11-8-13-9-16-11/h3-9H,2H2,1H3 |
| InChIKey | PTCAPRBNIYRNST-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |