C14H15N3O2 — CID 110857948
N-ethyl-2-methyl-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide (PubChem CID 110857948) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-ethyl-2-methyl-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide.
| Compound Name | N-ethyl-2-methyl-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110857948 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-ethyl-2-methyl-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide |
| SMILES | CCN(C(=O)c1cnc(C)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O2/c1-3-17(11-7-5-4-6-8-11)14(19)12-9-15-10(2)16-13(12)18/h4-9H,3H2,1-2H3,(H,15,16,18) |
| InChIKey | PKAPKKKISIDGME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |