C17H26N2O — CID 110858395
N-(2-tert-butylphenyl)-1-methylpiperidine-2-carboxamide (PubChem CID 110858395) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-1-methylpiperidine-2-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 110858395 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-(2-tert-butylphenyl)-1-methylpiperidine-2-carboxamide |
| SMILES | CN1CCCCC1C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C17H26N2O/c1-17(2,3)13-9-5-6-10-14(13)18-16(20)15-11-7-8-12-19(15)4/h5-6,9-10,15H,7-8,11-12H2,1-4H3,(H,18,20) |
| InChIKey | SCZIHLVFMUZPNL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |