C20H25N3O2 — CID 110862214
1,4,6-trimethyl-2-oxo-N-(4-piperidin-1-ylphenyl)pyridine-3-carboxamide (PubChem CID 110862214) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1,4,6-trimethyl-2-oxo-N-(4-piperidin-1-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 1,4,6-trimethyl-2-oxo-N-(4-piperidin-1-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110862214 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1,4,6-trimethyl-2-oxo-N-(4-piperidin-1-ylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-13-15(2)22(3)20(25)18(14)19(24)21-16-7-9-17(10-8-16)23-11-5-4-6-12-23/h7-10,13H,4-6,11-12H2,1-3H3,(H,21,24) |
| InChIKey | OFRLWPLUHSDNCQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|