C22H18N2O2 — CID 110862596
N-benzyl-2-oxo-N-phenyl-1,3-dihydroindole-5-carboxamide (PubChem CID 110862596) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-benzyl-2-oxo-N-phenyl-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-benzyl-2-oxo-N-phenyl-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 110862596 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-benzyl-2-oxo-N-phenyl-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)N(Cc3ccccc3)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C22H18N2O2/c25-21-14-18-13-17(11-12-20(18)23-21)22(26)24(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-13H,14-15H2,(H,23,25) |
| InChIKey | NOCOQGUTKKIYIW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |