C14H19NO4 — CID 11086674
dimethyl (1S,4R)-3-butyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2,7-dicarboxylate (PubChem CID 11086674) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is dimethyl (1S,4R)-3-butyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2,7-dicarboxylate.
| Compound Name | dimethyl (1S,4R)-3-butyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 11086674 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | dimethyl (1S,4R)-3-butyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2,7-dicarboxylate |
| SMILES | CCCCC1=C(C(=O)OC)[C@@H]2C=C[C@H]1N2C(=O)OC |
| InChI | InChI=1S/C14H19NO4/c1-4-5-6-9-10-7-8-11(12(9)13(16)18-2)15(10)14(17)19-3/h7-8,10-11H,4-6H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | GTOJYJKPUGSXIN-MNOVXSKESA-N |
| XLogP | 2.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|