C17H24N2O4 — CID 110867143
1-tert-butyl-4-(3,5-dimethoxybenzoyl)piperazin-2-one (PubChem CID 110867143) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,5-dimethoxybenzoyl)piperazin-2-one.
| Compound Name | 1-tert-butyl-4-(3,5-dimethoxybenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 110867143 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-tert-butyl-4-(3,5-dimethoxybenzoyl)piperazin-2-one |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(C)(C)C)C(=O)C2)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(2,3)19-7-6-18(11-15(19)20)16(21)12-8-13(22-4)10-14(9-12)23-5/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | LWMLZEBVCKOTDW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |